C18H21N3O4S — CID 9441778
4-[3-[(2,4-dimethylphenyl)sulfonylamino]propanoylamino]benzamide (PubChem CID 9441778) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[3-[(2,4-dimethylphenyl)sulfonylamino]propanoylamino]benzamide.
| Compound Name | 4-[3-[(2,4-dimethylphenyl)sulfonylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 9441778 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[3-[(2,4-dimethylphenyl)sulfonylamino]propanoylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)Nc2ccc(C(N)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H21N3O4S/c1-12-3-8-16(13(2)11-12)26(24,25)20-10-9-17(22)21-15-6-4-14(5-7-15)18(19)23/h3-8,11,20H,9-10H2,1-2H3,(H2,19,23)(H,21,22) |
| InChIKey | RWPAMILBEFJJAG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |