C12H17N — CID 94423264
(1S)-5-ethyl-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 94423264) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (1S)-5-ethyl-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1S)-5-ethyl-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 94423264 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (1S)-5-ethyl-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCc1cccc2c1CCN[C@H]2C |
| InChI | InChI=1S/C12H17N/c1-3-10-5-4-6-11-9(2)13-8-7-12(10)11/h4-6,9,13H,3,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | FKGJHLODIMXJEB-VIFPVBQESA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |