C18H21FN4O2 — CID 94432774
1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 94432774) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 94432774 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | O=C(CCCNc1ncccn1)N1CCO[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H21FN4O2/c19-15-6-4-14(5-7-15)16-13-23(11-12-25-16)17(24)3-1-8-20-18-21-9-2-10-22-18/h2,4-7,9-10,16H,1,3,8,11-13H2,(H,20,21,22)/t16-/m1/s1 |
| InChIKey | WDQPCNRVAMHGSU-MRXNPFEDSA-N |
| XLogP | 2.41 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|