C16H24FN2O+ — CID 9444040
(2S)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-1-ium-1-yl)propanamide (PubChem CID 9444040) has the molecular formula C16H24FN2O+ and a molecular weight of 279.38 g/mol. Its IUPAC name is (2S)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 9444040 |
| Molecular Formula | C16H24FN2O+ |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (2S)-N-(3-fluoro-4-methylphenyl)-2-(4-methylpiperidin-1-ium-1-yl)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)[NH+]2CCC(C)CC2)cc1F |
| InChI | InChI=1S/C16H23FN2O/c1-11-6-8-19(9-7-11)13(3)16(20)18-14-5-4-12(2)15(17)10-14/h4-5,10-11,13H,6-9H2,1-3H3,(H,18,20)/p+1/t13-/m0/s1 |
| InChIKey | WVOWFIWDTBBERC-ZDUSSCGKSA-O |
| XLogP | 1.78 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |