C19H32N6O3 — CID 94441053
4-butanoyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide (PubChem CID 94441053) has the molecular formula C19H32N6O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-butanoyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-butanoyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 94441053 |
| Molecular Formula | C19H32N6O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 4-butanoyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide |
| SMILES | CCCC(=O)N1CCCN(C(=O)NCCCn2nc3n(c2=O)CCCC3)CC1 |
| InChI | InChI=1S/C19H32N6O3/c1-2-7-17(26)22-10-6-11-23(15-14-22)18(27)20-9-5-13-25-19(28)24-12-4-3-8-16(24)21-25/h2-15H2,1H3,(H,20,27) |
| InChIKey | UTYZIMJGVPYTBW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|