C19H28N2O2 — CID 9444335
(2R)-N-(2-acetylphenyl)-2-(cyclooctylamino)propanamide (PubChem CID 9444335) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2R)-N-(2-acetylphenyl)-2-(cyclooctylamino)propanamide.
| Compound Name | (2R)-N-(2-acetylphenyl)-2-(cyclooctylamino)propanamide |
|---|---|
| PubChem CID | 9444335 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2R)-N-(2-acetylphenyl)-2-(cyclooctylamino)propanamide |
| SMILES | CC(=O)c1ccccc1NC(=O)[C@@H](C)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H28N2O2/c1-14(20-16-10-6-4-3-5-7-11-16)19(23)21-18-13-9-8-12-17(18)15(2)22/h8-9,12-14,16,20H,3-7,10-11H2,1-2H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | SZOUPJIWIBMNQJ-CQSZACIVSA-N |
| XLogP | 3.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |