C12H12Cl2N2O — CID 94444869
2-[[(1R,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]acetonitrile (PubChem CID 94444869) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 2-[[(1R,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]acetonitrile.
| Compound Name | 2-[[(1R,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]acetonitrile |
|---|---|
| PubChem CID | 94444869 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-[[(1R,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]acetonitrile |
| SMILES | CN(CC#N)[C@@H]1c2cc(Cl)cc(Cl)c2C[C@@H]1O |
| InChI | InChI=1S/C12H12Cl2N2O/c1-16(3-2-15)12-9-4-7(13)5-10(14)8(9)6-11(12)17/h4-5,11-12,17H,3,6H2,1H3/t11-,12+/m0/s1 |
| InChIKey | DLVJBLCKFWEMJN-NWDGAFQWSA-N |
| XLogP | 2.41 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|