C11H13N5 — CID 944503
(3-benzyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide (PubChem CID 944503) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is (3-benzyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide.
| Compound Name | (3-benzyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide |
|---|---|
| PubChem CID | 944503 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (3-benzyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)cyanamide |
| SMILES | N#CNC1=NCN(Cc2ccccc2)CN1 |
| InChI | InChI=1S/C11H13N5/c12-7-13-11-14-8-16(9-15-11)6-10-4-2-1-3-5-10/h1-5H,6,8-9H2,(H2,13,14,15) |
| InChIKey | ZETWHUQIVXOREE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|