About ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate
ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate (PubChem CID 9445268) has the molecular formula C12H17N3O4S2
and a molecular weight of 331.42 g/mol. Its IUPAC name is ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate |
| PubChem CID | 9445268 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCC(=O)NNC(=O)Cc1nc(C)cs1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-3-19-12(18)7-20-6-10(17)15-14-9(16)4-11-13-8(2)5-21-11/h5H,3-4,6-7H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | JYRCFNIKOADZSM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate?
The IUPAC name of ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate (CID 9445268) is ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate.
What is the SMILES notation for ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate?
The canonical SMILES for ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate is CCOC(=O)CSCC(=O)NNC(=O)Cc1nc(C)cs1.
What is the InChIKey of ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate?
The InChIKey is JYRCFNIKOADZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4S2/c1-3-19-12(18)7-20-6-10(17)15-14-9(16)4-11-13-8(2)5-21-11/h5H,3-4,6-7H2,1-2H3,(H,14,16)(H,15,17).
What are the key properties of ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate?
ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate has a molecular weight of 331.42 g/mol, XLogP of 0.44, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl]sulfanylacetate is sourced from PubChem (CID 9445268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).