C22H20F2N2O — CID 9445859
(2R)-2-(benzhydrylamino)-N-(2,6-difluorophenyl)propanamide (PubChem CID 9445859) has the molecular formula C22H20F2N2O and a molecular weight of 366.41 g/mol. Its IUPAC name is (2R)-2-(benzhydrylamino)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | (2R)-2-(benzhydrylamino)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 9445859 |
| Molecular Formula | C22H20F2N2O |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (2R)-2-(benzhydrylamino)-N-(2,6-difluorophenyl)propanamide |
| SMILES | C[C@@H](NC(c1ccccc1)c1ccccc1)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C22H20F2N2O/c1-15(22(27)26-21-18(23)13-8-14-19(21)24)25-20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-15,20,25H,1H3,(H,26,27)/t15-/m1/s1 |
| InChIKey | FJJQAUGWCJQCRZ-OAHLLOKOSA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |