C18H20Cl2N4O — CID 9446073
(2R)-N-(2,6-dichlorophenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)propanamide (PubChem CID 9446073) has the molecular formula C18H20Cl2N4O and a molecular weight of 379.29 g/mol. Its IUPAC name is (2R)-N-(2,6-dichlorophenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)propanamide.
| Compound Name | (2R)-N-(2,6-dichlorophenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 9446073 |
| Molecular Formula | C18H20Cl2N4O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (2R)-N-(2,6-dichlorophenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1c(Cl)cccc1Cl)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H20Cl2N4O/c1-13(18(25)22-17-14(19)5-4-6-15(17)20)23-9-11-24(12-10-23)16-7-2-3-8-21-16/h2-8,13H,9-12H2,1H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | JDTPBJZNWBHGOT-CYBMUJFWSA-N |
| XLogP | 3.54 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |