About (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid
(E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid (PubChem CID 94462022) has the molecular formula C6H11FN2O2
and a molecular weight of 162.16 g/mol. Its IUPAC name is (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid.
Molecular Properties
| Compound Name | (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid |
| PubChem CID | 94462022 |
| Molecular Formula | C6H11FN2O2 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid |
| SMILES | NC/C=C/[C@@](N)(CF)C(=O)O |
| InChI | InChI=1S/C6H11FN2O2/c7-4-6(9,5(10)11)2-1-3-8/h1-2H,3-4,8-9H2,(H,10,11)/b2-1+/t6-/m1/s1 |
| InChIKey | VZKIJNFPNWRGLM-UGQQDIOTSA-N |
| XLogP | -0.75 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid?
The IUPAC name of (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid (CID 94462022) is (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid.
What is the SMILES notation for (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid?
The canonical SMILES for (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid is NC/C=C/[C@@](N)(CF)C(=O)O.
What is the InChIKey of (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid?
The InChIKey is VZKIJNFPNWRGLM-UGQQDIOTSA-N. The full InChI is InChI=1S/C6H11FN2O2/c7-4-6(9,5(10)11)2-1-3-8/h1-2H,3-4,8-9H2,(H,10,11)/b2-1+/t6-/m1/s1.
What are the key properties of (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid?
(E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid has a molecular weight of 162.16 g/mol, XLogP of -0.75, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-2,5-diamino-2-(fluoromethyl)pent-3-enoic acid is sourced from PubChem (CID 94462022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).