C17H26NO3+ — CID 944678
(2S,11R)-11-hydroxy-1,7,7-trimethyl-10-oxa-1-azoniatetracyclo[10.2.2.02,11.04,9]hexadec-4(9)-en-5-one (PubChem CID 944678) has the molecular formula C17H26NO3+ and a molecular weight of 292.40 g/mol. Its IUPAC name is (2S,11R)-11-hydroxy-1,7,7-trimethyl-10-oxa-1-azoniatetracyclo[10.2.2.02,11.04,9]hexadec-4(9)-en-5-one.
| Compound Name | (2S,11R)-11-hydroxy-1,7,7-trimethyl-10-oxa-1-azoniatetracyclo[10.2.2.02,11.04,9]hexadec-4(9)-en-5-one |
|---|---|
| PubChem CID | 944678 |
| Molecular Formula | C17H26NO3+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2S,11R)-11-hydroxy-1,7,7-trimethyl-10-oxa-1-azoniatetracyclo[10.2.2.02,11.04,9]hexadec-4(9)-en-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@]1(O)C3CC[N+](C)(CC3)[C@H]1C2 |
| InChI | InChI=1S/C17H26NO3/c1-16(2)9-13(19)12-8-15-17(20,21-14(12)10-16)11-4-6-18(15,3)7-5-11/h11,15,20H,4-10H2,1-3H3/q+1/t11?,15-,17+,18?/m0/s1 |
| InChIKey | IBNCOQGTIBFHBE-HMCZVOIBSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|