C19H27N5O2 — CID 94469376
N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide (PubChem CID 94469376) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 94469376 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
| SMILES | Cc1ccccc1-c1nnn(CC(=O)NCCO[C@H]2CCCC[C@H]2C)n1 |
| InChI | InChI=1S/C19H27N5O2/c1-14-7-3-5-9-16(14)19-21-23-24(22-19)13-18(25)20-11-12-26-17-10-6-4-8-15(17)2/h3,5,7,9,15,17H,4,6,8,10-13H2,1-2H3,(H,20,25)/t15-,17+/m1/s1 |
| InChIKey | XNRPWOZERRMSPU-WBVHZDCISA-N |
| XLogP | 2.36 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|