C16H14Cl2N4OS — CID 9447641
(5Z)-5-[[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 9447641) has the molecular formula C16H14Cl2N4OS and a molecular weight of 381.29 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 9447641 |
| Molecular Formula | C16H14Cl2N4OS |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | (5Z)-5-[[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1/C=C1\NC(=S)NC1=O |
| InChI | InChI=1S/C16H14Cl2N4OS/c1-8-10(6-14-15(23)20-16(24)19-14)9(2)22(21-8)7-11-12(17)4-3-5-13(11)18/h3-6H,7H2,1-2H3,(H2,19,20,23,24)/b14-6- |
| InChIKey | SBUXIXAAPCYFNH-NSIKDUERSA-N |
| XLogP | 3.20 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|