About ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate
ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate (PubChem CID 94477906) has the molecular formula C16H24N2O4S
and a molecular weight of 340.45 g/mol. Its IUPAC name is ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate |
| PubChem CID | 94477906 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NC(=O)c1sc(NC(=O)C(C)(C)C)cc1C |
| InChI | InChI=1S/C16H24N2O4S/c1-7-22-14(20)10(3)17-13(19)12-9(2)8-11(23-12)18-15(21)16(4,5)6/h8,10H,7H2,1-6H3,(H,17,19)(H,18,21)/t10-/m1/s1 |
| InChIKey | LLWRMEIDZNSRQH-SNVBAGLBSA-N |
| XLogP | 2.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate?
The IUPAC name of ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate (CID 94477906) is ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate.
What is the SMILES notation for ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate?
The canonical SMILES for ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate is CCOC(=O)[C@@H](C)NC(=O)c1sc(NC(=O)C(C)(C)C)cc1C.
What is the InChIKey of ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate?
The InChIKey is LLWRMEIDZNSRQH-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H24N2O4S/c1-7-22-14(20)10(3)17-13(19)12-9(2)8-11(23-12)18-15(21)16(4,5)6/h8,10H,7H2,1-6H3,(H,17,19)(H,18,21)/t10-/m1/s1.
What are the key properties of ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate?
ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate has a molecular weight of 340.45 g/mol, XLogP of 2.72, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[[5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carbonyl]amino]propanoate is sourced from PubChem (CID 94477906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).