C18H20N4O4S — CID 9448113
ethyl (Z)-3-(3,5-dimethoxyphenyl)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)prop-2-enoate (PubChem CID 9448113) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is ethyl (Z)-3-(3,5-dimethoxyphenyl)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-(3,5-dimethoxyphenyl)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9448113 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl (Z)-3-(3,5-dimethoxyphenyl)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1cc(OC)cc(OC)c1)C1=Nn2c(C)nnc2SC1 |
| InChI | InChI=1S/C18H20N4O4S/c1-5-26-17(23)15(8-12-6-13(24-3)9-14(7-12)25-4)16-10-27-18-20-19-11(2)22(18)21-16/h6-9H,5,10H2,1-4H3/b15-8- |
| InChIKey | NJYVOSNSGUOCHG-NVNXTCNLSA-N |
| XLogP | 2.56 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|