C19H20N4O3S — CID 9448118
ethyl (Z)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-3-(3-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 9448118) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is ethyl (Z)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-3-(3-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (Z)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-3-(3-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9448118 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | ethyl (Z)-2-(3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl)-3-(3-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1cccc(/C=C(\C(=O)OCC)C2=Nn3c(C)nnc3SC2)c1 |
| InChI | InChI=1S/C19H20N4O3S/c1-4-9-26-15-8-6-7-14(10-15)11-16(18(24)25-5-2)17-12-27-19-21-20-13(3)23(19)22-17/h4,6-8,10-11H,1,5,9,12H2,2-3H3/b16-11- |
| InChIKey | XRFHUBUXQXYZNI-WJDWOHSUSA-N |
| XLogP | 3.11 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|