C30H23ClN2O5S — CID 94483847
(5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 94483847) has the molecular formula C30H23ClN2O5S and a molecular weight of 559.04 g/mol. Its IUPAC name is (5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 94483847 |
| Molecular Formula | C30H23ClN2O5S |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | (5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc([C@H]2C(=C(O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2c2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C30H23ClN2O5S/c1-3-12-37-21-8-4-17(5-9-21)26-25(27(34)18-6-11-23-19(14-18)13-16(2)38-23)28(35)29(36)33(26)30-32-22-10-7-20(31)15-24(22)39-30/h3-11,14-16,26,34H,1,12-13H2,2H3/t16-,26-/m0/s1 |
| InChIKey | MPHZLDYCWXABLD-QMTYFTJSSA-N |
| XLogP | 6.46 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|