C16H18ClNO4 — CID 94486869
[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone (PubChem CID 94486869) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is [(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone.
| Compound Name | [(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
|---|---|
| PubChem CID | 94486869 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
| SMILES | O=C(c1cc(Cl)c2c(c1)OCCO2)N1CCO[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C16H18ClNO4/c17-11-8-10(9-14-15(11)22-7-6-21-14)16(19)18-4-5-20-13-3-1-2-12(13)18/h8-9,12-13H,1-7H2/t12-,13+/m1/s1 |
| InChIKey | SLEKGGORQLWWRC-OLZOCXBDSA-N |
| XLogP | 2.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |