C20H24N2O3 — CID 94486974
1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]ethanone (PubChem CID 94486974) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]ethanone.
| Compound Name | 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 94486974 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]ethanone |
| SMILES | CC(=O)N1C=Cc2ccccc2[C@@H]1CC(=O)N1CCO[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C20H24N2O3/c1-14(23)21-10-9-15-5-2-3-6-16(15)18(21)13-20(24)22-11-12-25-19-8-4-7-17(19)22/h2-3,5-6,9-10,17-19H,4,7-8,11-13H2,1H3/t17-,18-,19+/m0/s1 |
| InChIKey | RBOGWAZKWOMNSO-GBESFXJTSA-N |
| XLogP | 2.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |