C16H23N3O3S — CID 94499205
N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]butane-1-sulfonamide (PubChem CID 94499205) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]butane-1-sulfonamide.
| Compound Name | N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 94499205 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)N[C@H](c1ccc(OC)cc1)c1nccn1C |
| InChI | InChI=1S/C16H23N3O3S/c1-4-5-12-23(20,21)18-15(16-17-10-11-19(16)2)13-6-8-14(22-3)9-7-13/h6-11,15,18H,4-5,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | KIMDFVMQDZMNII-OAHLLOKOSA-N |
| XLogP | 2.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |