About 1-fluoronaphthalene
1-fluoronaphthalene (PubChem CID 9450) has the molecular formula C10H7F
and a molecular weight of 146.16 g/mol. Its IUPAC name is 1-fluoronaphthalene.
Molecular Properties
| Compound Name | 1-fluoronaphthalene |
| PubChem CID | 9450 |
| Molecular Formula | C10H7F |
| Molecular Weight | 146.16 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 1-fluoronaphthalene |
| SMILES | Fc1cccc2ccccc12 |
| InChI | InChI=1S/C10H7F/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | CWLKTJOTWITYSI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoronaphthalene?
The IUPAC name of 1-fluoronaphthalene (CID 9450) is 1-fluoronaphthalene.
What is the SMILES notation for 1-fluoronaphthalene?
The canonical SMILES for 1-fluoronaphthalene is Fc1cccc2ccccc12.
What is the InChIKey of 1-fluoronaphthalene?
The InChIKey is CWLKTJOTWITYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H.
What are the key properties of 1-fluoronaphthalene?
1-fluoronaphthalene has a molecular weight of 146.16 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoronaphthalene is sourced from PubChem (CID 9450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).