About N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide
N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide (PubChem CID 9450255) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide |
| PubChem CID | 9450255 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1ncnc2sccc12 |
| InChI | InChI=1S/C12H16N4OS/c1-12(2,3)16-9(17)6-13-10-8-4-5-18-11(8)15-7-14-10/h4-5,7H,6H2,1-3H3,(H,16,17)(H,13,14,15) |
| InChIKey | AUOACQRDYIUYHM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide?
The IUPAC name of N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide (CID 9450255) is N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide.
What is the SMILES notation for N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide?
The canonical SMILES for N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide is CC(C)(C)NC(=O)CNc1ncnc2sccc12.
What is the InChIKey of N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide?
The InChIKey is AUOACQRDYIUYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-12(2,3)16-9(17)6-13-10-8-4-5-18-11(8)15-7-14-10/h4-5,7H,6H2,1-3H3,(H,16,17)(H,13,14,15).
What are the key properties of N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide?
N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide has a molecular weight of 264.35 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide is sourced from PubChem (CID 9450255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).