C15H21F2N3O — CID 94503931
1-(2,4-difluorophenyl)-3-[[(3S)-1-propylpyrrolidin-3-yl]methyl]urea (PubChem CID 94503931) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[[(3S)-1-propylpyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[[(3S)-1-propylpyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 94503931 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[[(3S)-1-propylpyrrolidin-3-yl]methyl]urea |
| SMILES | CCCN1CC[C@@H](CNC(=O)Nc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C15H21F2N3O/c1-2-6-20-7-5-11(10-20)9-18-15(21)19-14-4-3-12(16)8-13(14)17/h3-4,8,11H,2,5-7,9-10H2,1H3,(H2,18,19,21)/t11-/m0/s1 |
| InChIKey | RNUKSOPVHKYAPR-NSHDSACASA-N |
| XLogP | 2.82 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |