About (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide
(3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide (PubChem CID 94506074) has the molecular formula C17H20N4O2S
and a molecular weight of 344.44 g/mol. Its IUPAC name is (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide |
| PubChem CID | 94506074 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide |
| SMILES | Cc1csc(NC(=O)c2ccc(N3CCC[C@@H](C(N)=O)C3)cc2)n1 |
| InChI | InChI=1S/C17H20N4O2S/c1-11-10-24-17(19-11)20-16(23)12-4-6-14(7-5-12)21-8-2-3-13(9-21)15(18)22/h4-7,10,13H,2-3,8-9H2,1H3,(H2,18,22)(H,19,20,23)/t13-/m1/s1 |
| InChIKey | UGRXPKSCOLTWPF-CYBMUJFWSA-N |
| XLogP | 2.41 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide?
The IUPAC name of (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide (CID 94506074) is (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide.
What is the SMILES notation for (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide?
The canonical SMILES for (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide is Cc1csc(NC(=O)c2ccc(N3CCC[C@@H](C(N)=O)C3)cc2)n1.
What is the InChIKey of (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide?
The InChIKey is UGRXPKSCOLTWPF-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H20N4O2S/c1-11-10-24-17(19-11)20-16(23)12-4-6-14(7-5-12)21-8-2-3-13(9-21)15(18)22/h4-7,10,13H,2-3,8-9H2,1H3,(H2,18,22)(H,19,20,23)/t13-/m1/s1.
What are the key properties of (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide?
(3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide has a molecular weight of 344.44 g/mol, XLogP of 2.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]phenyl]piperidine-3-carboxamide is sourced from PubChem (CID 94506074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).