C24H29N3O2 — CID 9451089
N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 9451089) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 9451089 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | COc1ccc([C@H](CNC(=O)c2ccc3[nH]c(C)c(C)c3c2)N2CCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-16-17(2)26-22-11-8-19(14-21(16)22)24(28)25-15-23(27-12-4-5-13-27)18-6-9-20(29-3)10-7-18/h6-11,14,23,26H,4-5,12-13,15H2,1-3H3,(H,25,28)/t23-/m0/s1 |
| InChIKey | RDDFFGLJJKNGGZ-QHCPKHFHSA-N |
| XLogP | 4.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|