C16H18N4O3S — CID 9451115
N-(3-cyanothiophen-2-yl)-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 9451115) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 9451115 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(CC(=O)Nc1sccc1C#N)C2=O |
| InChI | InChI=1S/C16H18N4O3S/c1-10-4-2-3-6-16(10)14(22)20(15(23)19-16)9-12(21)18-13-11(8-17)5-7-24-13/h5,7,10H,2-4,6,9H2,1H3,(H,18,21)(H,19,23)/t10-,16-/m1/s1 |
| InChIKey | ZOGVXABLWLHUGF-QLJPJBMISA-N |
| XLogP | 2.06 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|