C17H16ClFN4O — CID 945115
(9R)-9-(2-chloro-6-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 945115) has the molecular formula C17H16ClFN4O and a molecular weight of 346.79 g/mol. Its IUPAC name is (9R)-9-(2-chloro-6-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(2-chloro-6-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 945115 |
| Molecular Formula | C17H16ClFN4O |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (9R)-9-(2-chloro-6-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ncnn1[C@H]2c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H16ClFN4O/c1-17(2)6-11-14(12(24)7-17)15(23-16(22-11)20-8-21-23)13-9(18)4-3-5-10(13)19/h3-5,8,15H,6-7H2,1-2H3,(H,20,21,22)/t15-/m0/s1 |
| InChIKey | NCILBLYLZSARDF-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |