C12H15NO — CID 945130
spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclopentane] (PubChem CID 945130) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclopentane].
| Compound Name | spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclopentane] |
|---|---|
| PubChem CID | 945130 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclopentane] |
| SMILES | c1ccc2c(c1)COC1(CCCC1)N2 |
| InChI | InChI=1S/C12H15NO/c1-2-6-11-10(5-1)9-14-12(13-11)7-3-4-8-12/h1-2,5-6,13H,3-4,7-9H2 |
| InChIKey | KIBJWHXJMUSDNW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |