About (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone
(7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 9451311) has the molecular formula C17H16ClN3O3
and a molecular weight of 345.79 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 9451311 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)c2c(c1)OCO2)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H16ClN3O3/c18-13-9-12(10-14-16(13)24-11-23-14)17(22)21-7-5-20(6-8-21)15-3-1-2-4-19-15/h1-4,9-10H,5-8,11H2 |
| InChIKey | YDNBHUKPFQXIKF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The IUPAC name of (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (CID 9451311) is (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone is O=C(c1cc(Cl)c2c(c1)OCO2)N1CCN(c2ccccn2)CC1.
What is the InChIKey of (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The InChIKey is YDNBHUKPFQXIKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O3/c18-13-9-12(10-14-16(13)24-11-23-14)17(22)21-7-5-20(6-8-21)15-3-1-2-4-19-15/h1-4,9-10H,5-8,11H2.
What are the key properties of (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone?
(7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone has a molecular weight of 345.79 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-1,3-benzodioxol-5-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 9451311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).