C20H17NO3S — CID 9451345
(3R,5S)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-methyloxolan-2-one (PubChem CID 9451345) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is (3R,5S)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-methyloxolan-2-one.
| Compound Name | (3R,5S)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 9451345 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (3R,5S)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-methyloxolan-2-one |
| SMILES | C[C@H]1C[C@@H](Sc2nc(-c3ccccc3)c(-c3ccccc3)o2)C(=O)O1 |
| InChI | InChI=1S/C20H17NO3S/c1-13-12-16(19(22)23-13)25-20-21-17(14-8-4-2-5-9-14)18(24-20)15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3/t13-,16+/m0/s1 |
| InChIKey | SOIHZPDWALMKBI-XJKSGUPXSA-N |
| XLogP | 4.80 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |