C16H23N3O2S — CID 94515003
1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(3-ethoxypropyl)-1-methylurea (PubChem CID 94515003) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(3-ethoxypropyl)-1-methylurea.
| Compound Name | 1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(3-ethoxypropyl)-1-methylurea |
|---|---|
| PubChem CID | 94515003 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(3-ethoxypropyl)-1-methylurea |
| SMILES | CCOCCCNC(=O)N(C)[C@H](C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H23N3O2S/c1-4-21-11-7-10-17-16(20)19(3)12(2)15-18-13-8-5-6-9-14(13)22-15/h5-6,8-9,12H,4,7,10-11H2,1-3H3,(H,17,20)/t12-/m1/s1 |
| InChIKey | JHGSFKSJNCTCCK-GFCCVEGCSA-N |
| XLogP | 3.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|