C18H18N2O5 — CID 9451778
N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-4-nitrobenzamide (PubChem CID 9451778) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-4-nitrobenzamide.
| Compound Name | N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9451778 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-4-nitrobenzamide |
| SMILES | CCOc1cc2c(cc1NC(=O)c1ccc([N+](=O)[O-])cc1)O[C@H](C)C2 |
| InChI | InChI=1S/C18H18N2O5/c1-3-24-17-9-13-8-11(2)25-16(13)10-15(17)19-18(21)12-4-6-14(7-5-12)20(22)23/h4-7,9-11H,3,8H2,1-2H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | BSDASJWMTFIWEI-LLVKDONJSA-N |
| XLogP | 3.57 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|