C19H23FN2O2 — CID 94518651
1-[(2R)-2-[4-[(3-fluorophenyl)methylidene]piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone (PubChem CID 94518651) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-[(2R)-2-[4-[(3-fluorophenyl)methylidene]piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-[4-[(3-fluorophenyl)methylidene]piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 94518651 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[(2R)-2-[4-[(3-fluorophenyl)methylidene]piperidine-1-carbonyl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H]1C(=O)N1CCC(=Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H23FN2O2/c1-14(23)22-9-3-6-18(22)19(24)21-10-7-15(8-11-21)12-16-4-2-5-17(20)13-16/h2,4-5,12-13,18H,3,6-11H2,1H3/t18-/m1/s1 |
| InChIKey | MFMVGNULTSNNDG-GOSISDBHSA-N |
| XLogP | 2.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |