About [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone
[(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 94521513) has the molecular formula C17H24N6O2
and a molecular weight of 344.42 g/mol. Its IUPAC name is [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone |
| PubChem CID | 94521513 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1nc(N2CCC[C@H](C(=O)N3CCOCC3)C2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C17H24N6O2/c1-12-19-15-14(10-18-21(15)2)16(20-12)23-5-3-4-13(11-23)17(24)22-6-8-25-9-7-22/h10,13H,3-9,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | CCBQILQDCISLPU-ZDUSSCGKSA-N |
| XLogP | 0.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
The IUPAC name of [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone (CID 94521513) is [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone is Cc1nc(N2CCC[C@H](C(=O)N3CCOCC3)C2)c2cnn(C)c2n1.
What is the InChIKey of [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
The InChIKey is CCBQILQDCISLPU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H24N6O2/c1-12-19-15-14(10-18-21(15)2)16(20-12)23-5-3-4-13(11-23)17(24)22-6-8-25-9-7-22/h10,13H,3-9,11H2,1-2H3/t13-/m0/s1.
What are the key properties of [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone?
[(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone has a molecular weight of 344.42 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 94521513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).