About bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate
bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate (PubChem CID 9454) has the molecular formula C14H14Cl3O6P
and a molecular weight of 415.59 g/mol. Its IUPAC name is bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate.
Molecular Properties
| Compound Name | bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate |
| PubChem CID | 9454 |
| Molecular Formula | C14H14Cl3O6P |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OP(=O)(OCCCl)OCCCl)ccc12 |
| InChI | InChI=1S/C14H14Cl3O6P/c1-9-11-3-2-10(8-12(11)22-14(18)13(9)17)23-24(19,20-6-4-15)21-7-5-16/h2-3,8H,4-7H2,1H3 |
| InChIKey | KULDXINYXFTXMO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate?
The IUPAC name of bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate (CID 9454) is bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate.
What is the SMILES notation for bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate?
The canonical SMILES for bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate is Cc1c(Cl)c(=O)oc2cc(OP(=O)(OCCCl)OCCCl)ccc12.
What is the InChIKey of bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate?
The InChIKey is KULDXINYXFTXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl3O6P/c1-9-11-3-2-10(8-12(11)22-14(18)13(9)17)23-24(19,20-6-4-15)21-7-5-16/h2-3,8H,4-7H2,1H3.
What are the key properties of bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate?
bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate has a molecular weight of 415.59 g/mol, XLogP of 4.75, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-chloroethyl) (3-chloro-4-methyl-2-oxochromen-7-yl) phosphate is sourced from PubChem (CID 9454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).