C15H17NO3 — CID 94547374
(1S)-2-pent-4-enoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 94547374) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (1S)-2-pent-4-enoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | (1S)-2-pent-4-enoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 94547374 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (1S)-2-pent-4-enoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | C=CCCC(=O)N1CCc2ccccc2[C@H]1C(=O)O |
| InChI | InChI=1S/C15H17NO3/c1-2-3-8-13(17)16-10-9-11-6-4-5-7-12(11)14(16)15(18)19/h2,4-7,14H,1,3,8-10H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | XESDREBWYFOCRH-AWEZNQCLSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|