C17H20N2O7 — CID 9454862
[2-[1-[(2S)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 9454862) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is [2-[1-[(2S)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[1-[(2S)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9454862 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [2-[1-[(2S)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | COC[C@H](C)n1c(C)cc(C(=O)COC(=O)c2ccc([N+](=O)[O-])o2)c1C |
| InChI | InChI=1S/C17H20N2O7/c1-10-7-13(12(3)18(10)11(2)8-24-4)14(20)9-25-17(21)15-5-6-16(26-15)19(22)23/h5-7,11H,8-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | VXVTZNFDFYGEGX-NSHDSACASA-N |
| XLogP | 2.85 |
| TPSA | 113.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|