C15H15N3O — CID 94549155
(1S)-1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propan-1-amine (PubChem CID 94549155) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is (1S)-1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propan-1-amine.
| Compound Name | (1S)-1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 94549155 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (1S)-1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)propan-1-amine |
| SMILES | CC[C@H](N)c1nc(-c2cccc3ccccc23)no1 |
| InChI | InChI=1S/C15H15N3O/c1-2-13(16)15-17-14(18-19-15)12-9-5-7-10-6-3-4-8-11(10)12/h3-9,13H,2,16H2,1H3/t13-/m0/s1 |
| InChIKey | NJPHNTZESJMTTB-ZDUSSCGKSA-N |
| XLogP | 3.30 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |