C21H18N2O6 — CID 9455517
[4-[(3-nitrobenzoyl)amino]phenyl] 2,4,5-trimethylfuran-3-carboxylate (PubChem CID 9455517) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is [4-[(3-nitrobenzoyl)amino]phenyl] 2,4,5-trimethylfuran-3-carboxylate.
| Compound Name | [4-[(3-nitrobenzoyl)amino]phenyl] 2,4,5-trimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 9455517 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [4-[(3-nitrobenzoyl)amino]phenyl] 2,4,5-trimethylfuran-3-carboxylate |
| SMILES | Cc1oc(C)c(C(=O)Oc2ccc(NC(=O)c3cccc([N+](=O)[O-])c3)cc2)c1C |
| InChI | InChI=1S/C21H18N2O6/c1-12-13(2)28-14(3)19(12)21(25)29-18-9-7-16(8-10-18)22-20(24)15-5-4-6-17(11-15)23(26)27/h4-11H,1-3H3,(H,22,24) |
| InChIKey | GRVOTYLYEXNNQU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|