About 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile
3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile (PubChem CID 94556811) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile |
| PubChem CID | 94556811 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile |
| SMILES | N#Cc1cccc([C@@H]2C[C@H]2CN)c1 |
| InChI | InChI=1S/C11H12N2/c12-6-8-2-1-3-9(4-8)11-5-10(11)7-13/h1-4,10-11H,5,7,13H2/t10-,11-/m0/s1 |
| InChIKey | MLQXPZHKJQNZTQ-QWRGUYRKSA-N |
| XLogP | 1.62 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile?
The IUPAC name of 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile (CID 94556811) is 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile.
What is the SMILES notation for 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile?
The canonical SMILES for 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile is N#Cc1cccc([C@@H]2C[C@H]2CN)c1.
What is the InChIKey of 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile?
The InChIKey is MLQXPZHKJQNZTQ-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H12N2/c12-6-8-2-1-3-9(4-8)11-5-10(11)7-13/h1-4,10-11H,5,7,13H2/t10-,11-/m0/s1.
What are the key properties of 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile?
3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile has a molecular weight of 172.23 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-(aminomethyl)cyclopropyl]benzonitrile is sourced from PubChem (CID 94556811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).