C10H11F2N — CID 94556815
[(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]methanamine (PubChem CID 94556815) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is [(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]methanamine.
| Compound Name | [(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 94556815 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | [(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]methanamine |
| SMILES | NC[C@@H]1C[C@@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C10H11F2N/c11-7-1-2-8(10(12)4-7)9-3-6(9)5-13/h1-2,4,6,9H,3,5,13H2/t6-,9-/m0/s1 |
| InChIKey | BMWZKXDXLODUFV-RCOVLWMOSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |