About ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate
ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate (PubChem CID 9455793) has the molecular formula C15H16O6S
and a molecular weight of 324.35 g/mol. Its IUPAC name is ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate.
Molecular Properties
| Compound Name | ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate |
| PubChem CID | 9455793 |
| Molecular Formula | C15H16O6S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(OC(=O)C[C@@H]2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H16O6S/c1-2-20-15(17)12-3-5-13(6-4-12)21-14(16)9-11-7-8-22(18,19)10-11/h3-8,11H,2,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | IVEKJJWHLOKOFT-NSHDSACASA-N |
| XLogP | 1.72 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate?
The IUPAC name of ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate (CID 9455793) is ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate.
What is the SMILES notation for ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate?
The canonical SMILES for ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate is CCOC(=O)c1ccc(OC(=O)C[C@@H]2C=CS(=O)(=O)C2)cc1.
What is the InChIKey of ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate?
The InChIKey is IVEKJJWHLOKOFT-NSHDSACASA-N. The full InChI is InChI=1S/C15H16O6S/c1-2-20-15(17)12-3-5-13(6-4-12)21-14(16)9-11-7-8-22(18,19)10-11/h3-8,11H,2,9-10H2,1H3/t11-/m0/s1.
What are the key properties of ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate?
ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate has a molecular weight of 324.35 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetyl]oxybenzoate is sourced from PubChem (CID 9455793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).