About dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate
dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate (PubChem CID 9456461) has the molecular formula C19H15ClO7
and a molecular weight of 390.78 g/mol. Its IUPAC name is dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate |
| PubChem CID | 9456461 |
| Molecular Formula | C19H15ClO7 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)[C@H]2Cc3cc(Cl)ccc3O2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H15ClO7/c1-24-17(21)11-5-12(18(22)25-2)8-14(7-11)26-19(23)16-9-10-6-13(20)3-4-15(10)27-16/h3-8,16H,9H2,1-2H3/t16-/m1/s1 |
| InChIKey | KOEHSMVHGFLEAL-MRXNPFEDSA-N |
| XLogP | 2.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate?
The IUPAC name of dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate (CID 9456461) is dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate?
The canonical SMILES for dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate is COC(=O)c1cc(OC(=O)[C@H]2Cc3cc(Cl)ccc3O2)cc(C(=O)OC)c1.
What is the InChIKey of dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate?
The InChIKey is KOEHSMVHGFLEAL-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H15ClO7/c1-24-17(21)11-5-12(18(22)25-2)8-14(7-11)26-19(23)16-9-10-6-13(20)3-4-15(10)27-16/h3-8,16H,9H2,1-2H3/t16-/m1/s1.
What are the key properties of dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate?
dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate has a molecular weight of 390.78 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-[(2R)-5-chloro-2,3-dihydro-1-benzofuran-2-carbonyl]oxybenzene-1,3-dicarboxylate is sourced from PubChem (CID 9456461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).