C17H18N2S — CID 945692
2-phenyl-1-prop-2-enyl-5,6,7,8-tetrahydroquinazoline-4-thione (PubChem CID 945692) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-phenyl-1-prop-2-enyl-5,6,7,8-tetrahydroquinazoline-4-thione.
| Compound Name | 2-phenyl-1-prop-2-enyl-5,6,7,8-tetrahydroquinazoline-4-thione |
|---|---|
| PubChem CID | 945692 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-phenyl-1-prop-2-enyl-5,6,7,8-tetrahydroquinazoline-4-thione |
| SMILES | C=CCn1c(-c2ccccc2)nc(=S)c2c1CCCC2 |
| InChI | InChI=1S/C17H18N2S/c1-2-12-19-15-11-7-6-10-14(15)17(20)18-16(19)13-8-4-3-5-9-13/h2-5,8-9H,1,6-7,10-12H2 |
| InChIKey | SEZJEGNRKGQFHL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|