About (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate
(3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate (PubChem CID 9457153) has the molecular formula C12H23N2OS2+
and a molecular weight of 275.46 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate.
Molecular Properties
| Compound Name | (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate |
| PubChem CID | 9457153 |
| Molecular Formula | C12H23N2OS2+ |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate |
| SMILES | C[NH+]1CCN(C(=S)SCC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22N2OS2/c1-12(2,3)10(15)9-17-11(16)14-7-5-13(4)6-8-14/h5-9H2,1-4H3/p+1 |
| InChIKey | KJSDOIYLLLLYJT-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate?
The IUPAC name of (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate (CID 9457153) is (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate.
What is the SMILES notation for (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate?
The canonical SMILES for (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate is C[NH+]1CCN(C(=S)SCC(=O)C(C)(C)C)CC1.
What is the InChIKey of (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate?
The InChIKey is KJSDOIYLLLLYJT-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H22N2OS2/c1-12(2,3)10(15)9-17-11(16)14-7-5-13(4)6-8-14/h5-9H2,1-4H3/p+1.
What are the key properties of (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate?
(3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate has a molecular weight of 275.46 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-oxobutyl) 4-methylpiperazin-4-ium-1-carbodithioate is sourced from PubChem (CID 9457153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).