C20H27F3N4O2 — CID 9459953
(2S)-N-(cyclopentylcarbamoyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide (PubChem CID 9459953) has the molecular formula C20H27F3N4O2 and a molecular weight of 412.46 g/mol. Its IUPAC name is (2S)-N-(cyclopentylcarbamoyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(cyclopentylcarbamoyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9459953 |
| Molecular Formula | C20H27F3N4O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S)-N-(cyclopentylcarbamoyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC(=O)NC1CCCC1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H27F3N4O2/c1-14(18(28)25-19(29)24-16-6-2-3-7-16)26-9-11-27(12-10-26)17-8-4-5-15(13-17)20(21,22)23/h4-5,8,13-14,16H,2-3,6-7,9-12H2,1H3,(H2,24,25,28,29)/t14-/m0/s1 |
| InChIKey | BLRDDBUJVNNZCY-AWEZNQCLSA-N |
| XLogP | 2.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |