C22H26N4O — CID 94601600
(2R)-N-methyl-2-(4-methylanilino)-N-[(1-methylimidazol-2-yl)methyl]-2-phenylpropanamide (PubChem CID 94601600) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is (2R)-N-methyl-2-(4-methylanilino)-N-[(1-methylimidazol-2-yl)methyl]-2-phenylpropanamide.
| Compound Name | (2R)-N-methyl-2-(4-methylanilino)-N-[(1-methylimidazol-2-yl)methyl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 94601600 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2R)-N-methyl-2-(4-methylanilino)-N-[(1-methylimidazol-2-yl)methyl]-2-phenylpropanamide |
| SMILES | Cc1ccc(N[C@@](C)(C(=O)N(C)Cc2nccn2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N4O/c1-17-10-12-19(13-11-17)24-22(2,18-8-6-5-7-9-18)21(27)26(4)16-20-23-14-15-25(20)3/h5-15,24H,16H2,1-4H3/t22-/m1/s1 |
| InChIKey | SMVFJRAXEUWYJM-JOCHJYFZSA-N |
| XLogP | 3.71 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |