About trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine
trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine (PubChem CID 94603912) has the molecular formula C13H16F3N
and a molecular weight of 243.27 g/mol. Its IUPAC name is trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| PubChem CID | 94603912 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3N/c14-13(15,16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)17/h1,3,5,7,10,12H,2,4,6,8,17H2/t10-,12+/m0/s1 |
| InChIKey | PUQDPGWQKAXIJC-CMPLNLGQSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine?
The IUPAC name of trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine (CID 94603912) is trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine.
What is the SMILES notation for trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine?
The canonical SMILES for trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine is N[C@@H]1CCCC[C@H]1c1ccccc1C(F)(F)F.
What is the InChIKey of trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine?
The InChIKey is PUQDPGWQKAXIJC-CMPLNLGQSA-N. The full InChI is InChI=1S/C13H16F3N/c14-13(15,16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)17/h1,3,5,7,10,12H,2,4,6,8,17H2/t10-,12+/m0/s1.
What are the key properties of trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine?
trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine has a molecular weight of 243.27 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclohexan-1-amine is sourced from PubChem (CID 94603912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).